C20H22FN3S — CID 66684361
6-(2-fluoro-3-pyridinyl)-2,2-dimethylspiro[1,3-dihydronaphthalene-4,4'-5,6-dihydro-1,3-thiazine]-2'-amine (PubChem CID 66684361) has the molecular formula C20H22FN3S and a molecular weight of 355.48 g/mol. Its IUPAC name is 6-(2-fluoro-3-pyridinyl)-2,2-dimethylspiro[1,3-dihydronaphthalene-4,4'-5,6-dihydro-1,3-thiazine]-2'-amine.
| Compound Name | 6-(2-fluoro-3-pyridinyl)-2,2-dimethylspiro[1,3-dihydronaphthalene-4,4'-5,6-dihydro-1,3-thiazine]-2'-amine |
|---|---|
| PubChem CID | 66684361 |
| Molecular Formula | C20H22FN3S |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | 6-(2-fluoro-3-pyridinyl)-2,2-dimethylspiro[1,3-dihydronaphthalene-4,4'-5,6-dihydro-1,3-thiazine]-2'-amine |
| SMILES | CC1(C)Cc2ccc(-c3cccnc3F)cc2C2(CCSC(N)=N2)C1 |
| InChI | InChI=1S/C20H22FN3S/c1-19(2)11-14-6-5-13(15-4-3-8-23-17(15)21)10-16(14)20(12-19)7-9-25-18(22)24-20/h3-6,8,10H,7,9,11-12H2,1-2H3,(H2,22,24) |
| InChIKey | PYRYHMNKKJHNMD-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 51.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|