C26H26ClNO2 — CID 66684728
(1R,2S,6R,7R)-4-[5-(4-chlorophenyl)-2-ethylphenyl]-5-hydroxy-8-methyliminotricyclo[5.2.2.02,6]undec-4-en-3-one (PubChem CID 66684728) has the molecular formula C26H26ClNO2 and a molecular weight of 419.95 g/mol. Its IUPAC name is (1R,2S,6R,7R)-4-[5-(4-chlorophenyl)-2-ethylphenyl]-5-hydroxy-8-methyliminotricyclo[5.2.2.02,6]undec-4-en-3-one.
| Compound Name | (1R,2S,6R,7R)-4-[5-(4-chlorophenyl)-2-ethylphenyl]-5-hydroxy-8-methyliminotricyclo[5.2.2.02,6]undec-4-en-3-one |
|---|---|
| PubChem CID | 66684728 |
| Molecular Formula | C26H26ClNO2 |
| Molecular Weight | 419.95 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | (1R,2S,6R,7R)-4-[5-(4-chlorophenyl)-2-ethylphenyl]-5-hydroxy-8-methyliminotricyclo[5.2.2.02,6]undec-4-en-3-one |
| SMILES | CCc1ccc(-c2ccc(Cl)cc2)cc1C1=C(O)[C@H]2[C@@H](C1=O)[C@@H]1CC[C@H]2/C(=N/C)C1 |
| InChI | InChI=1S/C26H26ClNO2/c1-3-14-4-5-16(15-6-9-18(27)10-7-15)12-20(14)24-25(29)22-17-8-11-19(21(13-17)28-2)23(22)26(24)30/h4-7,9-10,12,17,19,22-23,30H,3,8,11,13H2,1-2H3/b28-21+/t17-,19+,22+,23-/m1/s1 |
| InChIKey | JCQAFTUPBFNUCF-QNFLRLLTSA-N |
| XLogP | 6.15 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.95 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|