C15H26O2 — CID 66684886
1,1-diethoxyethane;1,3,5-trimethylbenzene (PubChem CID 66684886) has the molecular formula C15H26O2 and a molecular weight of 238.37 g/mol. Its IUPAC name is 1,1-diethoxyethane;1,3,5-trimethylbenzene.
| Compound Name | 1,1-diethoxyethane;1,3,5-trimethylbenzene |
|---|---|
| PubChem CID | 66684886 |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | 1,1-diethoxyethane;1,3,5-trimethylbenzene |
| SMILES | CCOC(C)OCC.Cc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C9H12.C6H14O2/c1-7-4-8(2)6-9(3)5-7;1-4-7-6(3)8-5-2/h4-6H,1-3H3;6H,4-5H2,1-3H3 |
| InChIKey | CVTSCCNAKUZKDI-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|