C26H27NO6 — CID 6668493
(2R,4R)-N-benzyl-2-(4-hydroxybutoxy)-4-(4-oxochromen-3-yl)-3,4-dihydro-2H-pyran-6-carboxamide (PubChem CID 6668493) has the molecular formula C26H27NO6 and a molecular weight of 449.50 g/mol. Its IUPAC name is (2R,4R)-N-benzyl-2-(4-hydroxybutoxy)-4-(4-oxochromen-3-yl)-3,4-dihydro-2H-pyran-6-carboxamide.
| Compound Name | (2R,4R)-N-benzyl-2-(4-hydroxybutoxy)-4-(4-oxochromen-3-yl)-3,4-dihydro-2H-pyran-6-carboxamide |
|---|---|
| PubChem CID | 6668493 |
| Molecular Formula | C26H27NO6 |
| Molecular Weight | 449.50 g/mol |
| Exact Mass | 449.18 |
| IUPAC Name | (2R,4R)-N-benzyl-2-(4-hydroxybutoxy)-4-(4-oxochromen-3-yl)-3,4-dihydro-2H-pyran-6-carboxamide |
| SMILES | O=C(NCc1ccccc1)C1=C[C@H](c2coc3ccccc3c2=O)C[C@H](OCCCCO)O1 |
| InChI | InChI=1S/C26H27NO6/c28-12-6-7-13-31-24-15-19(21-17-32-22-11-5-4-10-20(22)25(21)29)14-23(33-24)26(30)27-16-18-8-2-1-3-9-18/h1-5,8-11,14,17,19,24,28H,6-7,12-13,15-16H2,(H,27,30)/t19-,24+/m0/s1 |
| InChIKey | FRUSNVDKBLAUPO-YADARESESA-N |
| XLogP | 3.61 |
| TPSA | 98.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.50 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|