About N-[(1S)-2,2-difluoro-1-(3-fluorophenyl)-2-phenylsulfanylethyl]prop-2-en-1-amine
N-[(1S)-2,2-difluoro-1-(3-fluorophenyl)-2-phenylsulfanylethyl]prop-2-en-1-amine (PubChem CID 66685042) has the molecular formula C17H16F3NS
and a molecular weight of 323.38 g/mol. Its IUPAC name is N-[(1S)-2,2-difluoro-1-(3-fluorophenyl)-2-phenylsulfanylethyl]prop-2-en-1-amine.
Molecular Properties
| Compound Name | N-[(1S)-2,2-difluoro-1-(3-fluorophenyl)-2-phenylsulfanylethyl]prop-2-en-1-amine |
| PubChem CID | 66685042 |
| Molecular Formula | C17H16F3NS |
| Molecular Weight | 323.38 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | N-[(1S)-2,2-difluoro-1-(3-fluorophenyl)-2-phenylsulfanylethyl]prop-2-en-1-amine |
| SMILES | C=CCN[C@@H](c1cccc(F)c1)C(F)(F)Sc1ccccc1 |
| InChI | InChI=1S/C17H16F3NS/c1-2-11-21-16(13-7-6-8-14(18)12-13)17(19,20)22-15-9-4-3-5-10-15/h2-10,12,16,21H,1,11H2/t16-/m0/s1 |
| InChIKey | JFUCHHYTWZMGAJ-INIZCTEOSA-N |
| XLogP | 5.03 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 323.38 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[(1S)-2,2-difluoro-1-(3-fluorophenyl)-2-phenylsulfanylethyl]prop-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1S)-2,2-difluoro-1-(3-fluorophenyl)-2-phenylsulfanylethyl]prop-2-en-1-amine?
The IUPAC name of N-[(1S)-2,2-difluoro-1-(3-fluorophenyl)-2-phenylsulfanylethyl]prop-2-en-1-amine (CID 66685042) is N-[(1S)-2,2-difluoro-1-(3-fluorophenyl)-2-phenylsulfanylethyl]prop-2-en-1-amine.
What is the SMILES notation for N-[(1S)-2,2-difluoro-1-(3-fluorophenyl)-2-phenylsulfanylethyl]prop-2-en-1-amine?
The canonical SMILES for N-[(1S)-2,2-difluoro-1-(3-fluorophenyl)-2-phenylsulfanylethyl]prop-2-en-1-amine is C=CCN[C@@H](c1cccc(F)c1)C(F)(F)Sc1ccccc1.
What is the InChIKey of N-[(1S)-2,2-difluoro-1-(3-fluorophenyl)-2-phenylsulfanylethyl]prop-2-en-1-amine?
The InChIKey is JFUCHHYTWZMGAJ-INIZCTEOSA-N. The full InChI is InChI=1S/C17H16F3NS/c1-2-11-21-16(13-7-6-8-14(18)12-13)17(19,20)22-15-9-4-3-5-10-15/h2-10,12,16,21H,1,11H2/t16-/m0/s1.
What are the key properties of N-[(1S)-2,2-difluoro-1-(3-fluorophenyl)-2-phenylsulfanylethyl]prop-2-en-1-amine?
N-[(1S)-2,2-difluoro-1-(3-fluorophenyl)-2-phenylsulfanylethyl]prop-2-en-1-amine has a molecular weight of 323.38 g/mol, XLogP of 5.03, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1S)-2,2-difluoro-1-(3-fluorophenyl)-2-phenylsulfanylethyl]prop-2-en-1-amine is sourced from PubChem (CID 66685042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).