About tert-butyl (2R,4R)-2-(3-fluorophenyl)-4-hydroxypyrrolidine-1-carboxylate
tert-butyl (2R,4R)-2-(3-fluorophenyl)-4-hydroxypyrrolidine-1-carboxylate (PubChem CID 66685055) has the molecular formula C15H20FNO3
and a molecular weight of 281.33 g/mol. Its IUPAC name is tert-butyl (2R,4R)-2-(3-fluorophenyl)-4-hydroxypyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl (2R,4R)-2-(3-fluorophenyl)-4-hydroxypyrrolidine-1-carboxylate |
| PubChem CID | 66685055 |
| Molecular Formula | C15H20FNO3 |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | tert-butyl (2R,4R)-2-(3-fluorophenyl)-4-hydroxypyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](O)C[C@@H]1c1cccc(F)c1 |
| InChI | InChI=1S/C15H20FNO3/c1-15(2,3)20-14(19)17-9-12(18)8-13(17)10-5-4-6-11(16)7-10/h4-7,12-13,18H,8-9H2,1-3H3/t12-,13-/m1/s1 |
| InChIKey | PVLFQKURRNRVEC-CHWSQXEVSA-N |
| XLogP | 2.87 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tert-butyl (2R,4R)-2-(3-fluorophenyl)-4-hydroxypyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (2R,4R)-2-(3-fluorophenyl)-4-hydroxypyrrolidine-1-carboxylate?
The IUPAC name of tert-butyl (2R,4R)-2-(3-fluorophenyl)-4-hydroxypyrrolidine-1-carboxylate (CID 66685055) is tert-butyl (2R,4R)-2-(3-fluorophenyl)-4-hydroxypyrrolidine-1-carboxylate.
What is the SMILES notation for tert-butyl (2R,4R)-2-(3-fluorophenyl)-4-hydroxypyrrolidine-1-carboxylate?
The canonical SMILES for tert-butyl (2R,4R)-2-(3-fluorophenyl)-4-hydroxypyrrolidine-1-carboxylate is CC(C)(C)OC(=O)N1C[C@H](O)C[C@@H]1c1cccc(F)c1.
What is the InChIKey of tert-butyl (2R,4R)-2-(3-fluorophenyl)-4-hydroxypyrrolidine-1-carboxylate?
The InChIKey is PVLFQKURRNRVEC-CHWSQXEVSA-N. The full InChI is InChI=1S/C15H20FNO3/c1-15(2,3)20-14(19)17-9-12(18)8-13(17)10-5-4-6-11(16)7-10/h4-7,12-13,18H,8-9H2,1-3H3/t12-,13-/m1/s1.
What are the key properties of tert-butyl (2R,4R)-2-(3-fluorophenyl)-4-hydroxypyrrolidine-1-carboxylate?
tert-butyl (2R,4R)-2-(3-fluorophenyl)-4-hydroxypyrrolidine-1-carboxylate has a molecular weight of 281.33 g/mol, XLogP of 2.87, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (2R,4R)-2-(3-fluorophenyl)-4-hydroxypyrrolidine-1-carboxylate is sourced from PubChem (CID 66685055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).