C44H60N4 — CID 66685160
2,3,5,7-tetrahexylporphyrin (PubChem CID 66685160) has the molecular formula C44H60N4 and a molecular weight of 644.99 g/mol. Its IUPAC name is 2,3,5,7-tetrahexylporphyrin.
| Compound Name | 2,3,5,7-tetrahexylporphyrin |
|---|---|
| PubChem CID | 66685160 |
| Molecular Formula | C44H60N4 |
| Molecular Weight | 644.99 g/mol |
| Exact Mass | 644.48 |
| IUPAC Name | 2,3,5,7-tetrahexylporphyrin |
| SMILES | CCCCCCC1=C/C2=C/C3=N/C(=C\C4=N/C(=C\C5=N/C(=C(/CCCCCC)C1=N2)C(CCCCCC)=C5CCCCCC)C=C4)C=C3 |
| InChI | InChI=1S/C44H60N4/c1-5-9-13-17-21-33-29-38-31-36-26-25-34(45-36)30-35-27-28-37(46-35)32-42-39(22-18-14-10-6-2)40(23-19-15-11-7-3)44(48-42)41(43(33)47-38)24-20-16-12-8-4/h25-32H,5-24H2,1-4H3/b34-30-,35-30-,36-31-,37-32-,38-31-,42-32-,43-41-,44-41- |
| InChIKey | ZFOXIDPEFOYAPO-UKVZKTGQSA-N |
| XLogP | 12.94 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.99 |
| LogP ≤ 5 | 12.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|