About ethyl 8-phenyl-3,4-dihydro-2H-pyrano[2,3-c]pyridine-6-carboxylate
ethyl 8-phenyl-3,4-dihydro-2H-pyrano[2,3-c]pyridine-6-carboxylate (PubChem CID 66685388) has the molecular formula C17H17NO3
and a molecular weight of 283.33 g/mol. Its IUPAC name is ethyl 8-phenyl-3,4-dihydro-2H-pyrano[2,3-c]pyridine-6-carboxylate.
Molecular Properties
| Compound Name | ethyl 8-phenyl-3,4-dihydro-2H-pyrano[2,3-c]pyridine-6-carboxylate |
| PubChem CID | 66685388 |
| Molecular Formula | C17H17NO3 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | ethyl 8-phenyl-3,4-dihydro-2H-pyrano[2,3-c]pyridine-6-carboxylate |
| SMILES | CCOC(=O)c1cc2c(c(-c3ccccc3)n1)OCCC2 |
| InChI | InChI=1S/C17H17NO3/c1-2-20-17(19)14-11-13-9-6-10-21-16(13)15(18-14)12-7-4-3-5-8-12/h3-5,7-8,11H,2,6,9-10H2,1H3 |
| InChIKey | PGZDIXARNADHDQ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 8-phenyl-3,4-dihydro-2H-pyrano[2,3-c]pyridine-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 8-phenyl-3,4-dihydro-2H-pyrano[2,3-c]pyridine-6-carboxylate?
The IUPAC name of ethyl 8-phenyl-3,4-dihydro-2H-pyrano[2,3-c]pyridine-6-carboxylate (CID 66685388) is ethyl 8-phenyl-3,4-dihydro-2H-pyrano[2,3-c]pyridine-6-carboxylate.
What is the SMILES notation for ethyl 8-phenyl-3,4-dihydro-2H-pyrano[2,3-c]pyridine-6-carboxylate?
The canonical SMILES for ethyl 8-phenyl-3,4-dihydro-2H-pyrano[2,3-c]pyridine-6-carboxylate is CCOC(=O)c1cc2c(c(-c3ccccc3)n1)OCCC2.
What is the InChIKey of ethyl 8-phenyl-3,4-dihydro-2H-pyrano[2,3-c]pyridine-6-carboxylate?
The InChIKey is PGZDIXARNADHDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17NO3/c1-2-20-17(19)14-11-13-9-6-10-21-16(13)15(18-14)12-7-4-3-5-8-12/h3-5,7-8,11H,2,6,9-10H2,1H3.
What are the key properties of ethyl 8-phenyl-3,4-dihydro-2H-pyrano[2,3-c]pyridine-6-carboxylate?
ethyl 8-phenyl-3,4-dihydro-2H-pyrano[2,3-c]pyridine-6-carboxylate has a molecular weight of 283.33 g/mol, XLogP of 3.25, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 8-phenyl-3,4-dihydro-2H-pyrano[2,3-c]pyridine-6-carboxylate is sourced from PubChem (CID 66685388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).