C21H20BrClN2O2 — CID 66685655
3-[4-(bromomethyl)phenyl]-5-[[1-(4-chlorophenyl)cyclobutyl]methoxymethyl]-1,2,4-oxadiazole (PubChem CID 66685655) has the molecular formula C21H20BrClN2O2 and a molecular weight of 447.76 g/mol. Its IUPAC name is 3-[4-(bromomethyl)phenyl]-5-[[1-(4-chlorophenyl)cyclobutyl]methoxymethyl]-1,2,4-oxadiazole.
| Compound Name | 3-[4-(bromomethyl)phenyl]-5-[[1-(4-chlorophenyl)cyclobutyl]methoxymethyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 66685655 |
| Molecular Formula | C21H20BrClN2O2 |
| Molecular Weight | 447.76 g/mol |
| Exact Mass | 446.04 |
| IUPAC Name | 3-[4-(bromomethyl)phenyl]-5-[[1-(4-chlorophenyl)cyclobutyl]methoxymethyl]-1,2,4-oxadiazole |
| SMILES | Clc1ccc(C2(COCc3nc(-c4ccc(CBr)cc4)no3)CCC2)cc1 |
| InChI | InChI=1S/C21H20BrClN2O2/c22-12-15-2-4-16(5-3-15)20-24-19(27-25-20)13-26-14-21(10-1-11-21)17-6-8-18(23)9-7-17/h2-9H,1,10-14H2 |
| InChIKey | RXIYIVCVCKGWPU-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.76 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|