C57H102O6 — CID 66685729
trihexadecan-8-yl benzene-1,2,4-tricarboxylate (PubChem CID 66685729) has the molecular formula C57H102O6 and a molecular weight of 883.44 g/mol. Its IUPAC name is trihexadecan-8-yl benzene-1,2,4-tricarboxylate.
| Compound Name | trihexadecan-8-yl benzene-1,2,4-tricarboxylate |
|---|---|
| PubChem CID | 66685729 |
| Molecular Formula | C57H102O6 |
| Molecular Weight | 883.44 g/mol |
| Exact Mass | 882.77 |
| IUPAC Name | trihexadecan-8-yl benzene-1,2,4-tricarboxylate |
| SMILES | CCCCCCCCC(CCCCCCC)OC(=O)c1ccc(C(=O)OC(CCCCCCC)CCCCCCCC)c(C(=O)OC(CCCCCCC)CCCCCCCC)c1 |
| InChI | InChI=1S/C57H102O6/c1-7-13-19-25-31-37-41-50(40-34-28-22-16-10-4)61-55(58)49-46-47-53(56(59)62-51(42-35-29-23-17-11-5)44-38-32-26-20-14-8-2)54(48-49)57(60)63-52(43-36-30-24-18-12-6)45-39-33-27-21-15-9-3/h46-48,50-52H,7-45H2,1-6H3 |
| InChIKey | CDIXWULXJOWYAN-UHFFFAOYSA-N |
| XLogP | 18.60 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 45 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 883.44 |
| LogP ≤ 5 | 18.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|