About 4-[2-[(Z)-prop-1-enoxy]butan-2-yl]-N,N-dipropylaniline
4-[2-[(Z)-prop-1-enoxy]butan-2-yl]-N,N-dipropylaniline (PubChem CID 66685870) has the molecular formula C19H31NO
and a molecular weight of 289.46 g/mol. Its IUPAC name is 4-[2-[(Z)-prop-1-enoxy]butan-2-yl]-N,N-dipropylaniline.
Molecular Properties
| Compound Name | 4-[2-[(Z)-prop-1-enoxy]butan-2-yl]-N,N-dipropylaniline |
| PubChem CID | 66685870 |
| Molecular Formula | C19H31NO |
| Molecular Weight | 289.46 g/mol |
| Exact Mass | 289.24 |
| IUPAC Name | 4-[2-[(Z)-prop-1-enoxy]butan-2-yl]-N,N-dipropylaniline |
| SMILES | C/C=C\OC(C)(CC)c1ccc(N(CCC)CCC)cc1 |
| InChI | InChI=1S/C19H31NO/c1-6-14-20(15-7-2)18-12-10-17(11-13-18)19(5,9-4)21-16-8-3/h8,10-13,16H,6-7,9,14-15H2,1-5H3/b16-8- |
| InChIKey | JKISCSJJUWJBKP-PXNMLYILSA-N |
| XLogP | 5.49 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 289.46 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-[(Z)-prop-1-enoxy]butan-2-yl]-N,N-dipropylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-[(Z)-prop-1-enoxy]butan-2-yl]-N,N-dipropylaniline?
The IUPAC name of 4-[2-[(Z)-prop-1-enoxy]butan-2-yl]-N,N-dipropylaniline (CID 66685870) is 4-[2-[(Z)-prop-1-enoxy]butan-2-yl]-N,N-dipropylaniline.
What is the SMILES notation for 4-[2-[(Z)-prop-1-enoxy]butan-2-yl]-N,N-dipropylaniline?
The canonical SMILES for 4-[2-[(Z)-prop-1-enoxy]butan-2-yl]-N,N-dipropylaniline is C/C=C\OC(C)(CC)c1ccc(N(CCC)CCC)cc1.
What is the InChIKey of 4-[2-[(Z)-prop-1-enoxy]butan-2-yl]-N,N-dipropylaniline?
The InChIKey is JKISCSJJUWJBKP-PXNMLYILSA-N. The full InChI is InChI=1S/C19H31NO/c1-6-14-20(15-7-2)18-12-10-17(11-13-18)19(5,9-4)21-16-8-3/h8,10-13,16H,6-7,9,14-15H2,1-5H3/b16-8-.
What are the key properties of 4-[2-[(Z)-prop-1-enoxy]butan-2-yl]-N,N-dipropylaniline?
4-[2-[(Z)-prop-1-enoxy]butan-2-yl]-N,N-dipropylaniline has a molecular weight of 289.46 g/mol, XLogP of 5.49, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-[(Z)-prop-1-enoxy]butan-2-yl]-N,N-dipropylaniline is sourced from PubChem (CID 66685870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).