C24H45N5O3 — CID 66686175
2-N,2-N,4-N-tris(butoxymethyl)-6-cyclopentyl-4-N-methyl-1,3,5-triazine-2,4-diamine (PubChem CID 66686175) has the molecular formula C24H45N5O3 and a molecular weight of 451.66 g/mol. Its IUPAC name is 2-N,2-N,4-N-tris(butoxymethyl)-6-cyclopentyl-4-N-methyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N,2-N,4-N-tris(butoxymethyl)-6-cyclopentyl-4-N-methyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 66686175 |
| Molecular Formula | C24H45N5O3 |
| Molecular Weight | 451.66 g/mol |
| Exact Mass | 451.35 |
| IUPAC Name | 2-N,2-N,4-N-tris(butoxymethyl)-6-cyclopentyl-4-N-methyl-1,3,5-triazine-2,4-diamine |
| SMILES | CCCCOCN(C)c1nc(C2CCCC2)nc(N(COCCCC)COCCCC)n1 |
| InChI | InChI=1S/C24H45N5O3/c1-5-8-15-30-18-28(4)23-25-22(21-13-11-12-14-21)26-24(27-23)29(19-31-16-9-6-2)20-32-17-10-7-3/h21H,5-20H2,1-4H3 |
| InChIKey | DJJQZBOGHMTWBX-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 72.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.66 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|