About 2-propan-2-yl-5-pyrrolidin-3-yl-1,3,4-oxadiazole;hydrobromide
2-propan-2-yl-5-pyrrolidin-3-yl-1,3,4-oxadiazole;hydrobromide (PubChem CID 66686246) has the molecular formula C9H16BrN3O
and a molecular weight of 262.15 g/mol. Its IUPAC name is 2-propan-2-yl-5-pyrrolidin-3-yl-1,3,4-oxadiazole;hydrobromide.
Molecular Properties
| Compound Name | 2-propan-2-yl-5-pyrrolidin-3-yl-1,3,4-oxadiazole;hydrobromide |
| PubChem CID | 66686246 |
| Molecular Formula | C9H16BrN3O |
| Molecular Weight | 262.15 g/mol |
| Exact Mass | 261.05 |
| IUPAC Name | 2-propan-2-yl-5-pyrrolidin-3-yl-1,3,4-oxadiazole;hydrobromide |
| SMILES | Br.CC(C)c1nnc(C2CCNC2)o1 |
| InChI | InChI=1S/C9H15N3O.BrH/c1-6(2)8-11-12-9(13-8)7-3-4-10-5-7;/h6-7,10H,3-5H2,1-2H3;1H |
| InChIKey | WKTSAZTZSUSJDW-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.15 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-propan-2-yl-5-pyrrolidin-3-yl-1,3,4-oxadiazole;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propan-2-yl-5-pyrrolidin-3-yl-1,3,4-oxadiazole;hydrobromide?
The IUPAC name of 2-propan-2-yl-5-pyrrolidin-3-yl-1,3,4-oxadiazole;hydrobromide (CID 66686246) is 2-propan-2-yl-5-pyrrolidin-3-yl-1,3,4-oxadiazole;hydrobromide.
What is the SMILES notation for 2-propan-2-yl-5-pyrrolidin-3-yl-1,3,4-oxadiazole;hydrobromide?
The canonical SMILES for 2-propan-2-yl-5-pyrrolidin-3-yl-1,3,4-oxadiazole;hydrobromide is Br.CC(C)c1nnc(C2CCNC2)o1.
What is the InChIKey of 2-propan-2-yl-5-pyrrolidin-3-yl-1,3,4-oxadiazole;hydrobromide?
The InChIKey is WKTSAZTZSUSJDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3O.BrH/c1-6(2)8-11-12-9(13-8)7-3-4-10-5-7;/h6-7,10H,3-5H2,1-2H3;1H.
What are the key properties of 2-propan-2-yl-5-pyrrolidin-3-yl-1,3,4-oxadiazole;hydrobromide?
2-propan-2-yl-5-pyrrolidin-3-yl-1,3,4-oxadiazole;hydrobromide has a molecular weight of 262.15 g/mol, XLogP of 1.85, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propan-2-yl-5-pyrrolidin-3-yl-1,3,4-oxadiazole;hydrobromide is sourced from PubChem (CID 66686246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).