C21H31NO7 — CID 6668634
(2R,4R)-N-(2,2-dimethoxyethyl)-2-[2-(2-hydroxyethoxy)ethoxy]-N-methyl-4-phenyl-3,4-dihydro-2H-pyran-6-carboxamide (PubChem CID 6668634) has the molecular formula C21H31NO7 and a molecular weight of 409.48 g/mol. Its IUPAC name is (2R,4R)-N-(2,2-dimethoxyethyl)-2-[2-(2-hydroxyethoxy)ethoxy]-N-methyl-4-phenyl-3,4-dihydro-2H-pyran-6-carboxamide.
| Compound Name | (2R,4R)-N-(2,2-dimethoxyethyl)-2-[2-(2-hydroxyethoxy)ethoxy]-N-methyl-4-phenyl-3,4-dihydro-2H-pyran-6-carboxamide |
|---|---|
| PubChem CID | 6668634 |
| Molecular Formula | C21H31NO7 |
| Molecular Weight | 409.48 g/mol |
| Exact Mass | 409.21 |
| IUPAC Name | (2R,4R)-N-(2,2-dimethoxyethyl)-2-[2-(2-hydroxyethoxy)ethoxy]-N-methyl-4-phenyl-3,4-dihydro-2H-pyran-6-carboxamide |
| SMILES | COC(CN(C)C(=O)C1=C[C@H](c2ccccc2)C[C@H](OCCOCCO)O1)OC |
| InChI | InChI=1S/C21H31NO7/c1-22(15-20(25-2)26-3)21(24)18-13-17(16-7-5-4-6-8-16)14-19(29-18)28-12-11-27-10-9-23/h4-8,13,17,19-20,23H,9-12,14-15H2,1-3H3/t17-,19+/m0/s1 |
| InChIKey | KBZQCJZDXWABCY-PKOBYXMFSA-N |
| XLogP | 1.50 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.48 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|