C23H33NO8 — CID 6668651
methyl 4-[(2S,4S)-6-[2,2-dimethoxyethyl(methyl)carbamoyl]-2-(4-hydroxybutoxy)-3,4-dihydro-2H-pyran-4-yl]benzoate (PubChem CID 6668651) has the molecular formula C23H33NO8 and a molecular weight of 451.52 g/mol. Its IUPAC name is methyl 4-[(2S,4S)-6-[2,2-dimethoxyethyl(methyl)carbamoyl]-2-(4-hydroxybutoxy)-3,4-dihydro-2H-pyran-4-yl]benzoate.
| Compound Name | methyl 4-[(2S,4S)-6-[2,2-dimethoxyethyl(methyl)carbamoyl]-2-(4-hydroxybutoxy)-3,4-dihydro-2H-pyran-4-yl]benzoate |
|---|---|
| PubChem CID | 6668651 |
| Molecular Formula | C23H33NO8 |
| Molecular Weight | 451.52 g/mol |
| Exact Mass | 451.22 |
| IUPAC Name | methyl 4-[(2S,4S)-6-[2,2-dimethoxyethyl(methyl)carbamoyl]-2-(4-hydroxybutoxy)-3,4-dihydro-2H-pyran-4-yl]benzoate |
| SMILES | COC(=O)c1ccc([C@@H]2C=C(C(=O)N(C)CC(OC)OC)O[C@H](OCCCCO)C2)cc1 |
| InChI | InChI=1S/C23H33NO8/c1-24(15-21(28-2)29-3)22(26)19-13-18(14-20(32-19)31-12-6-5-11-25)16-7-9-17(10-8-16)23(27)30-4/h7-10,13,18,20-21,25H,5-6,11-12,14-15H2,1-4H3/t18-,20+/m1/s1 |
| InChIKey | ADTSTTASRGOCBZ-QUCCMNQESA-N |
| XLogP | 2.05 |
| TPSA | 103.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.52 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|