C28H35ClN6O3 — CID 66686521
4-chloro-9-(2,2-dimethylpropyl)-7-[2-[4-(3-methyl-6-oxo-1H-pyridazin-5-yl)piperidin-1-yl]-2-oxoethyl]-3,6,7,10-tetrahydropyrazolo[3,4-i][2]benzazepin-8-one (PubChem CID 66686521) has the molecular formula C28H35ClN6O3 and a molecular weight of 539.08 g/mol. Its IUPAC name is 4-chloro-9-(2,2-dimethylpropyl)-7-[2-[4-(3-methyl-6-oxo-1H-pyridazin-5-yl)piperidin-1-yl]-2-oxoethyl]-3,6,7,10-tetrahydropyrazolo[3,4-i][2]benzazepin-8-one.
| Compound Name | 4-chloro-9-(2,2-dimethylpropyl)-7-[2-[4-(3-methyl-6-oxo-1H-pyridazin-5-yl)piperidin-1-yl]-2-oxoethyl]-3,6,7,10-tetrahydropyrazolo[3,4-i][2]benzazepin-8-one |
|---|---|
| PubChem CID | 66686521 |
| Molecular Formula | C28H35ClN6O3 |
| Molecular Weight | 539.08 g/mol |
| Exact Mass | 538.25 |
| IUPAC Name | 4-chloro-9-(2,2-dimethylpropyl)-7-[2-[4-(3-methyl-6-oxo-1H-pyridazin-5-yl)piperidin-1-yl]-2-oxoethyl]-3,6,7,10-tetrahydropyrazolo[3,4-i][2]benzazepin-8-one |
| SMILES | Cc1cc(C2CCN(C(=O)CC3Cc4cc(Cl)c5[nH]ncc5c4CN(CC(C)(C)C)C3=O)CC2)c(=O)[nH]n1 |
| InChI | InChI=1S/C28H35ClN6O3/c1-16-9-20(26(37)33-31-16)17-5-7-34(8-6-17)24(36)12-19-10-18-11-23(29)25-21(13-30-32-25)22(18)14-35(27(19)38)15-28(2,3)4/h9,11,13,17,19H,5-8,10,12,14-15H2,1-4H3,(H,30,32)(H,33,37) |
| InChIKey | JTRPLZBDSDBCKW-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 115.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.08 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |