About ethyl 3-amino-4-(2,4,5-trifluorophenyl)but-2-enoate
ethyl 3-amino-4-(2,4,5-trifluorophenyl)but-2-enoate (PubChem CID 66686964) has the molecular formula C12H12F3NO2
and a molecular weight of 259.23 g/mol. Its IUPAC name is ethyl 3-amino-4-(2,4,5-trifluorophenyl)but-2-enoate.
Molecular Properties
| Compound Name | ethyl 3-amino-4-(2,4,5-trifluorophenyl)but-2-enoate |
| PubChem CID | 66686964 |
| Molecular Formula | C12H12F3NO2 |
| Molecular Weight | 259.23 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | ethyl 3-amino-4-(2,4,5-trifluorophenyl)but-2-enoate |
| SMILES | CCOC(=O)C=C(N)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C12H12F3NO2/c1-2-18-12(17)5-8(16)3-7-4-10(14)11(15)6-9(7)13/h4-6H,2-3,16H2,1H3 |
| InChIKey | SFBGUVPIIJRHFD-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.23 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-amino-4-(2,4,5-trifluorophenyl)but-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-amino-4-(2,4,5-trifluorophenyl)but-2-enoate?
The IUPAC name of ethyl 3-amino-4-(2,4,5-trifluorophenyl)but-2-enoate (CID 66686964) is ethyl 3-amino-4-(2,4,5-trifluorophenyl)but-2-enoate.
What is the SMILES notation for ethyl 3-amino-4-(2,4,5-trifluorophenyl)but-2-enoate?
The canonical SMILES for ethyl 3-amino-4-(2,4,5-trifluorophenyl)but-2-enoate is CCOC(=O)C=C(N)Cc1cc(F)c(F)cc1F.
What is the InChIKey of ethyl 3-amino-4-(2,4,5-trifluorophenyl)but-2-enoate?
The InChIKey is SFBGUVPIIJRHFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12F3NO2/c1-2-18-12(17)5-8(16)3-7-4-10(14)11(15)6-9(7)13/h4-6H,2-3,16H2,1H3.
What are the key properties of ethyl 3-amino-4-(2,4,5-trifluorophenyl)but-2-enoate?
ethyl 3-amino-4-(2,4,5-trifluorophenyl)but-2-enoate has a molecular weight of 259.23 g/mol, XLogP of 2.05, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-amino-4-(2,4,5-trifluorophenyl)but-2-enoate is sourced from PubChem (CID 66686964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).