About 3-phenyl-[1]benzofuro[3,2-c]pyridine
3-phenyl-[1]benzofuro[3,2-c]pyridine (PubChem CID 66687355) has the molecular formula C17H11NO
and a molecular weight of 245.28 g/mol. Its IUPAC name is 3-phenyl-[1]benzofuro[3,2-c]pyridine.
Molecular Properties
| Compound Name | 3-phenyl-[1]benzofuro[3,2-c]pyridine |
| PubChem CID | 66687355 |
| Molecular Formula | C17H11NO |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | 3-phenyl-[1]benzofuro[3,2-c]pyridine |
| SMILES | c1ccc(-c2cc3oc4ccccc4c3cn2)cc1 |
| InChI | InChI=1S/C17H11NO/c1-2-6-12(7-3-1)15-10-17-14(11-18-15)13-8-4-5-9-16(13)19-17/h1-11H |
| InChIKey | LWBHSYUSIYXGMV-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-phenyl-[1]benzofuro[3,2-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenyl-[1]benzofuro[3,2-c]pyridine?
The IUPAC name of 3-phenyl-[1]benzofuro[3,2-c]pyridine (CID 66687355) is 3-phenyl-[1]benzofuro[3,2-c]pyridine.
What is the SMILES notation for 3-phenyl-[1]benzofuro[3,2-c]pyridine?
The canonical SMILES for 3-phenyl-[1]benzofuro[3,2-c]pyridine is c1ccc(-c2cc3oc4ccccc4c3cn2)cc1.
What is the InChIKey of 3-phenyl-[1]benzofuro[3,2-c]pyridine?
The InChIKey is LWBHSYUSIYXGMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11NO/c1-2-6-12(7-3-1)15-10-17-14(11-18-15)13-8-4-5-9-16(13)19-17/h1-11H.
What are the key properties of 3-phenyl-[1]benzofuro[3,2-c]pyridine?
3-phenyl-[1]benzofuro[3,2-c]pyridine has a molecular weight of 245.28 g/mol, XLogP of 4.65, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenyl-[1]benzofuro[3,2-c]pyridine is sourced from PubChem (CID 66687355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).