C30H24O6 — CID 66687732
(2S)-5,7-dihydroxy-2-(4-hydroxyphenyl)-2,3-dihydrochromen-4-one;1,3-diphenylprop-2-en-1-one (PubChem CID 66687732) has the molecular formula C30H24O6 and a molecular weight of 480.52 g/mol. Its IUPAC name is (2S)-5,7-dihydroxy-2-(4-hydroxyphenyl)-2,3-dihydrochromen-4-one;1,3-diphenylprop-2-en-1-one.
| Compound Name | (2S)-5,7-dihydroxy-2-(4-hydroxyphenyl)-2,3-dihydrochromen-4-one;1,3-diphenylprop-2-en-1-one |
|---|---|
| PubChem CID | 66687732 |
| Molecular Formula | C30H24O6 |
| Molecular Weight | 480.52 g/mol |
| Exact Mass | 480.16 |
| IUPAC Name | (2S)-5,7-dihydroxy-2-(4-hydroxyphenyl)-2,3-dihydrochromen-4-one;1,3-diphenylprop-2-en-1-one |
| SMILES | O=C(C=Cc1ccccc1)c1ccccc1.O=C1C[C@@H](c2ccc(O)cc2)Oc2cc(O)cc(O)c21 |
| InChI | InChI=1S/C15H12O5.C15H12O/c16-9-3-1-8(2-4-9)13-7-12(19)15-11(18)5-10(17)6-14(15)20-13;16-15(14-9-5-2-6-10-14)12-11-13-7-3-1-4-8-13/h1-6,13,16-18H,7H2;1-12H/t13-;/m0./s1 |
| InChIKey | YYVNAZCWVQHPMW-ZOWNYOTGSA-N |
| XLogP | 6.09 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.52 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|