C30H20N4O2S — CID 66687794
(4Z)-4-(5-benzoyl-3-phenyl-1,3,4-thiadiazol-2-ylidene)-2,5-diphenylpyrazol-3-one (PubChem CID 66687794) has the molecular formula C30H20N4O2S and a molecular weight of 500.58 g/mol. Its IUPAC name is (4Z)-4-(5-benzoyl-3-phenyl-1,3,4-thiadiazol-2-ylidene)-2,5-diphenylpyrazol-3-one.
| Compound Name | (4Z)-4-(5-benzoyl-3-phenyl-1,3,4-thiadiazol-2-ylidene)-2,5-diphenylpyrazol-3-one |
|---|---|
| PubChem CID | 66687794 |
| Molecular Formula | C30H20N4O2S |
| Molecular Weight | 500.58 g/mol |
| Exact Mass | 500.13 |
| IUPAC Name | (4Z)-4-(5-benzoyl-3-phenyl-1,3,4-thiadiazol-2-ylidene)-2,5-diphenylpyrazol-3-one |
| SMILES | O=C(C1=NN(c2ccccc2)/C(=C2/C(=O)N(c3ccccc3)N=C2c2ccccc2)S1)c1ccccc1 |
| InChI | InChI=1S/C30H20N4O2S/c35-27(22-15-7-2-8-16-22)28-32-34(24-19-11-4-12-20-24)30(37-28)25-26(21-13-5-1-6-14-21)31-33(29(25)36)23-17-9-3-10-18-23/h1-20H/b30-25- |
| InChIKey | UIOLCTMVPNSOLL-JVCXMKTPSA-N |
| XLogP | 6.10 |
| TPSA | 65.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.58 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|