About 3,4-bis(ethenoxy)thiophene
3,4-bis(ethenoxy)thiophene (PubChem CID 66687977) has the molecular formula C8H8O2S
and a molecular weight of 168.22 g/mol. Its IUPAC name is 3,4-bis(ethenoxy)thiophene.
Molecular Properties
| Compound Name | 3,4-bis(ethenoxy)thiophene |
| PubChem CID | 66687977 |
| Molecular Formula | C8H8O2S |
| Molecular Weight | 168.22 g/mol |
| Exact Mass | 168.02 |
| IUPAC Name | 3,4-bis(ethenoxy)thiophene |
| SMILES | C=COc1cscc1OC=C |
| InChI | InChI=1S/C8H8O2S/c1-3-9-7-5-11-6-8(7)10-4-2/h3-6H,1-2H2 |
| InChIKey | FYQLFBWSHGTQLX-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.22 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 3,4-bis(ethenoxy)thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-bis(ethenoxy)thiophene?
The IUPAC name of 3,4-bis(ethenoxy)thiophene (CID 66687977) is 3,4-bis(ethenoxy)thiophene.
What is the SMILES notation for 3,4-bis(ethenoxy)thiophene?
The canonical SMILES for 3,4-bis(ethenoxy)thiophene is C=COc1cscc1OC=C.
What is the InChIKey of 3,4-bis(ethenoxy)thiophene?
The InChIKey is FYQLFBWSHGTQLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O2S/c1-3-9-7-5-11-6-8(7)10-4-2/h3-6H,1-2H2.
What are the key properties of 3,4-bis(ethenoxy)thiophene?
3,4-bis(ethenoxy)thiophene has a molecular weight of 168.22 g/mol, XLogP of 2.79, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-bis(ethenoxy)thiophene is sourced from PubChem (CID 66687977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).