C24H27O7P — CID 66688043
[2-(2,6-dimethoxybenzoyl)-2-phosphorosocyclohexyl]-(2,6-dimethoxyphenyl)methanone (PubChem CID 66688043) has the molecular formula C24H27O7P and a molecular weight of 458.45 g/mol. Its IUPAC name is [2-(2,6-dimethoxybenzoyl)-2-phosphorosocyclohexyl]-(2,6-dimethoxyphenyl)methanone.
| Compound Name | [2-(2,6-dimethoxybenzoyl)-2-phosphorosocyclohexyl]-(2,6-dimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 66688043 |
| Molecular Formula | C24H27O7P |
| Molecular Weight | 458.45 g/mol |
| Exact Mass | 458.15 |
| IUPAC Name | [2-(2,6-dimethoxybenzoyl)-2-phosphorosocyclohexyl]-(2,6-dimethoxyphenyl)methanone |
| SMILES | COc1cccc(OC)c1C(=O)C1CCCCC1(P=O)C(=O)c1c(OC)cccc1OC |
| InChI | InChI=1S/C24H27O7P/c1-28-16-10-7-11-17(29-2)20(16)22(25)15-9-5-6-14-24(15,32-27)23(26)21-18(30-3)12-8-13-19(21)31-4/h7-8,10-13,15H,5-6,9,14H2,1-4H3 |
| InChIKey | DYXPYZBPKPPYJI-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.45 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|