About 1-(2-methyl-1,3-dioxolan-2-yl)imidazole
1-(2-methyl-1,3-dioxolan-2-yl)imidazole (PubChem CID 66688291) has the molecular formula C7H10N2O2
and a molecular weight of 154.17 g/mol. Its IUPAC name is 1-(2-methyl-1,3-dioxolan-2-yl)imidazole.
Molecular Properties
| Compound Name | 1-(2-methyl-1,3-dioxolan-2-yl)imidazole |
| PubChem CID | 66688291 |
| Molecular Formula | C7H10N2O2 |
| Molecular Weight | 154.17 g/mol |
| Exact Mass | 154.07 |
| IUPAC Name | 1-(2-methyl-1,3-dioxolan-2-yl)imidazole |
| SMILES | CC1(n2ccnc2)OCCO1 |
| InChI | InChI=1S/C7H10N2O2/c1-7(10-4-5-11-7)9-3-2-8-6-9/h2-3,6H,4-5H2,1H3 |
| InChIKey | IQHMRYBBVYKLBV-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.17 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(2-methyl-1,3-dioxolan-2-yl)imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-methyl-1,3-dioxolan-2-yl)imidazole?
The IUPAC name of 1-(2-methyl-1,3-dioxolan-2-yl)imidazole (CID 66688291) is 1-(2-methyl-1,3-dioxolan-2-yl)imidazole.
What is the SMILES notation for 1-(2-methyl-1,3-dioxolan-2-yl)imidazole?
The canonical SMILES for 1-(2-methyl-1,3-dioxolan-2-yl)imidazole is CC1(n2ccnc2)OCCO1.
What is the InChIKey of 1-(2-methyl-1,3-dioxolan-2-yl)imidazole?
The InChIKey is IQHMRYBBVYKLBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O2/c1-7(10-4-5-11-7)9-3-2-8-6-9/h2-3,6H,4-5H2,1H3.
What are the key properties of 1-(2-methyl-1,3-dioxolan-2-yl)imidazole?
1-(2-methyl-1,3-dioxolan-2-yl)imidazole has a molecular weight of 154.17 g/mol, XLogP of 0.56, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-methyl-1,3-dioxolan-2-yl)imidazole is sourced from PubChem (CID 66688291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).