About tert-butyl (2S,4S)-2-(3-cyano-5-fluorophenyl)-4-fluoropyrrolidine-1-carboxylate
tert-butyl (2S,4S)-2-(3-cyano-5-fluorophenyl)-4-fluoropyrrolidine-1-carboxylate (PubChem CID 66688374) has the molecular formula C16H18F2N2O2
and a molecular weight of 308.33 g/mol. Its IUPAC name is tert-butyl (2S,4S)-2-(3-cyano-5-fluorophenyl)-4-fluoropyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl (2S,4S)-2-(3-cyano-5-fluorophenyl)-4-fluoropyrrolidine-1-carboxylate |
| PubChem CID | 66688374 |
| Molecular Formula | C16H18F2N2O2 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | tert-butyl (2S,4S)-2-(3-cyano-5-fluorophenyl)-4-fluoropyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](F)C[C@H]1c1cc(F)cc(C#N)c1 |
| InChI | InChI=1S/C16H18F2N2O2/c1-16(2,3)22-15(21)20-9-13(18)7-14(20)11-4-10(8-19)5-12(17)6-11/h4-6,13-14H,7,9H2,1-3H3/t13-,14-/m0/s1 |
| InChIKey | ZIBIKKCEIIJTMK-KBPBESRZSA-N |
| XLogP | 3.72 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tert-butyl (2S,4S)-2-(3-cyano-5-fluorophenyl)-4-fluoropyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (2S,4S)-2-(3-cyano-5-fluorophenyl)-4-fluoropyrrolidine-1-carboxylate?
The IUPAC name of tert-butyl (2S,4S)-2-(3-cyano-5-fluorophenyl)-4-fluoropyrrolidine-1-carboxylate (CID 66688374) is tert-butyl (2S,4S)-2-(3-cyano-5-fluorophenyl)-4-fluoropyrrolidine-1-carboxylate.
What is the SMILES notation for tert-butyl (2S,4S)-2-(3-cyano-5-fluorophenyl)-4-fluoropyrrolidine-1-carboxylate?
The canonical SMILES for tert-butyl (2S,4S)-2-(3-cyano-5-fluorophenyl)-4-fluoropyrrolidine-1-carboxylate is CC(C)(C)OC(=O)N1C[C@@H](F)C[C@H]1c1cc(F)cc(C#N)c1.
What is the InChIKey of tert-butyl (2S,4S)-2-(3-cyano-5-fluorophenyl)-4-fluoropyrrolidine-1-carboxylate?
The InChIKey is ZIBIKKCEIIJTMK-KBPBESRZSA-N. The full InChI is InChI=1S/C16H18F2N2O2/c1-16(2,3)22-15(21)20-9-13(18)7-14(20)11-4-10(8-19)5-12(17)6-11/h4-6,13-14H,7,9H2,1-3H3/t13-,14-/m0/s1.
What are the key properties of tert-butyl (2S,4S)-2-(3-cyano-5-fluorophenyl)-4-fluoropyrrolidine-1-carboxylate?
tert-butyl (2S,4S)-2-(3-cyano-5-fluorophenyl)-4-fluoropyrrolidine-1-carboxylate has a molecular weight of 308.33 g/mol, XLogP of 3.72, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (2S,4S)-2-(3-cyano-5-fluorophenyl)-4-fluoropyrrolidine-1-carboxylate is sourced from PubChem (CID 66688374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).