C30H36N2O8 — CID 6668933
(2R,3R,4S)-4-(1-acetylindol-3-yl)-2-ethoxy-3-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-N-(2-hydroxyphenyl)-3,4-dihydro-2H-pyran-6-carboxamide (PubChem CID 6668933) has the molecular formula C30H36N2O8 and a molecular weight of 552.62 g/mol. Its IUPAC name is (2R,3R,4S)-4-(1-acetylindol-3-yl)-2-ethoxy-3-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-N-(2-hydroxyphenyl)-3,4-dihydro-2H-pyran-6-carboxamide.
| Compound Name | (2R,3R,4S)-4-(1-acetylindol-3-yl)-2-ethoxy-3-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-N-(2-hydroxyphenyl)-3,4-dihydro-2H-pyran-6-carboxamide |
|---|---|
| PubChem CID | 6668933 |
| Molecular Formula | C30H36N2O8 |
| Molecular Weight | 552.62 g/mol |
| Exact Mass | 552.25 |
| IUPAC Name | (2R,3R,4S)-4-(1-acetylindol-3-yl)-2-ethoxy-3-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-N-(2-hydroxyphenyl)-3,4-dihydro-2H-pyran-6-carboxamide |
| SMILES | CCO[C@@H]1OC(C(=O)Nc2ccccc2O)=C[C@H](c2cn(C(C)=O)c3ccccc23)[C@H]1CCOCCOCCO |
| InChI | InChI=1S/C30H36N2O8/c1-3-39-30-22(12-14-37-16-17-38-15-13-33)23(24-19-32(20(2)34)26-10-6-4-8-21(24)26)18-28(40-30)29(36)31-25-9-5-7-11-27(25)35/h4-11,18-19,22-23,30,33,35H,3,12-17H2,1-2H3,(H,31,36)/t22-,23+,30-/m1/s1 |
| InChIKey | IFIOPKOOTIMKAI-DUELTEGESA-N |
| XLogP | 4.04 |
| TPSA | 128.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.62 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|