C17H26N2O3S — CID 66689672
4-[(tert-butylsulfinylamino)-phenylmethyl]piperidine-1-carboxylic acid (PubChem CID 66689672) has the molecular formula C17H26N2O3S and a molecular weight of 338.47 g/mol. Its IUPAC name is 4-[(tert-butylsulfinylamino)-phenylmethyl]piperidine-1-carboxylic acid.
| Compound Name | 4-[(tert-butylsulfinylamino)-phenylmethyl]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 66689672 |
| Molecular Formula | C17H26N2O3S |
| Molecular Weight | 338.47 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | 4-[(tert-butylsulfinylamino)-phenylmethyl]piperidine-1-carboxylic acid |
| SMILES | CC(C)(C)S(=O)NC(c1ccccc1)C1CCN(C(=O)O)CC1 |
| InChI | InChI=1S/C17H26N2O3S/c1-17(2,3)23(22)18-15(13-7-5-4-6-8-13)14-9-11-19(12-10-14)16(20)21/h4-8,14-15,18H,9-12H2,1-3H3,(H,20,21) |
| InChIKey | RLJIZHGJAPRBCY-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.47 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |