C24H26N4O2 — CID 66689834
N-cyclopropyl-4-methyl-3-[2-oxo-3-(3-phenylpropylamino)pyrazin-1-yl]benzamide (PubChem CID 66689834) has the molecular formula C24H26N4O2 and a molecular weight of 402.50 g/mol. Its IUPAC name is N-cyclopropyl-4-methyl-3-[2-oxo-3-(3-phenylpropylamino)pyrazin-1-yl]benzamide.
| Compound Name | N-cyclopropyl-4-methyl-3-[2-oxo-3-(3-phenylpropylamino)pyrazin-1-yl]benzamide |
|---|---|
| PubChem CID | 66689834 |
| Molecular Formula | C24H26N4O2 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | N-cyclopropyl-4-methyl-3-[2-oxo-3-(3-phenylpropylamino)pyrazin-1-yl]benzamide |
| SMILES | Cc1ccc(C(=O)NC2CC2)cc1-n1ccnc(NCCCc2ccccc2)c1=O |
| InChI | InChI=1S/C24H26N4O2/c1-17-9-10-19(23(29)27-20-11-12-20)16-21(17)28-15-14-26-22(24(28)30)25-13-5-8-18-6-3-2-4-7-18/h2-4,6-7,9-10,14-16,20H,5,8,11-13H2,1H3,(H,25,26)(H,27,29) |
| InChIKey | GFDWALYDXLGNQR-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|