C23H20ClF3N4OS — CID 66690104
N-[2-chloro-4-[[4-cyano-3-[4-(trifluoromethyl)phenyl]-1,2-thiazol-5-yl]oxy]-5-methylphenyl]-N',2-dimethylpropanimidamide (PubChem CID 66690104) has the molecular formula C23H20ClF3N4OS and a molecular weight of 492.95 g/mol. Its IUPAC name is N-[2-chloro-4-[[4-cyano-3-[4-(trifluoromethyl)phenyl]-1,2-thiazol-5-yl]oxy]-5-methylphenyl]-N',2-dimethylpropanimidamide.
| Compound Name | N-[2-chloro-4-[[4-cyano-3-[4-(trifluoromethyl)phenyl]-1,2-thiazol-5-yl]oxy]-5-methylphenyl]-N',2-dimethylpropanimidamide |
|---|---|
| PubChem CID | 66690104 |
| Molecular Formula | C23H20ClF3N4OS |
| Molecular Weight | 492.95 g/mol |
| Exact Mass | 492.10 |
| IUPAC Name | N-[2-chloro-4-[[4-cyano-3-[4-(trifluoromethyl)phenyl]-1,2-thiazol-5-yl]oxy]-5-methylphenyl]-N',2-dimethylpropanimidamide |
| SMILES | C/N=C(/Nc1cc(C)c(Oc2snc(-c3ccc(C(F)(F)F)cc3)c2C#N)cc1Cl)C(C)C |
| InChI | InChI=1S/C23H20ClF3N4OS/c1-12(2)21(29-4)30-18-9-13(3)19(10-17(18)24)32-22-16(11-28)20(31-33-22)14-5-7-15(8-6-14)23(25,26)27/h5-10,12H,1-4H3,(H,29,30) |
| InChIKey | YMDSFVPAQFKFEY-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 70.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.95 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|