C10H11N3 — CID 66690157
2,3,3a,4-tetrahydro-1H-pyrrolo[2,3-f]quinazoline (PubChem CID 66690157) has the molecular formula C10H11N3 and a molecular weight of 173.22 g/mol. Its IUPAC name is 2,3,3a,4-tetrahydro-1H-pyrrolo[2,3-f]quinazoline.
| Compound Name | 2,3,3a,4-tetrahydro-1H-pyrrolo[2,3-f]quinazoline |
|---|---|
| PubChem CID | 66690157 |
| Molecular Formula | C10H11N3 |
| Molecular Weight | 173.22 g/mol |
| Exact Mass | 173.10 |
| IUPAC Name | 2,3,3a,4-tetrahydro-1H-pyrrolo[2,3-f]quinazoline |
| SMILES | C1=c2ncncc2=C2NCCC2C1 |
| InChI | InChI=1S/C10H11N3/c1-2-9-8(5-11-6-13-9)10-7(1)3-4-12-10/h2,5-7,12H,1,3-4H2 |
| InChIKey | HVEDHJOKDBRFRO-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.22 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |