C21H19FN4OS — CID 66690371
N'-[4-[[4-cyano-3-(3-fluorophenyl)-1,2-thiazol-5-yl]oxy]-2,5-dimethylphenyl]-N,N-dimethylmethanimidamide (PubChem CID 66690371) has the molecular formula C21H19FN4OS and a molecular weight of 394.48 g/mol. Its IUPAC name is N'-[4-[[4-cyano-3-(3-fluorophenyl)-1,2-thiazol-5-yl]oxy]-2,5-dimethylphenyl]-N,N-dimethylmethanimidamide.
| Compound Name | N'-[4-[[4-cyano-3-(3-fluorophenyl)-1,2-thiazol-5-yl]oxy]-2,5-dimethylphenyl]-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 66690371 |
| Molecular Formula | C21H19FN4OS |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | N'-[4-[[4-cyano-3-(3-fluorophenyl)-1,2-thiazol-5-yl]oxy]-2,5-dimethylphenyl]-N,N-dimethylmethanimidamide |
| SMILES | Cc1cc(Oc2snc(-c3cccc(F)c3)c2C#N)c(C)cc1/N=C/N(C)C |
| InChI | InChI=1S/C21H19FN4OS/c1-13-9-19(14(2)8-18(13)24-12-26(3)4)27-21-17(11-23)20(25-28-21)15-6-5-7-16(22)10-15/h5-10,12H,1-4H3/b24-12+ |
| InChIKey | AXSBZLFNXLMXIC-WYMPLXKRSA-N |
| XLogP | 5.45 |
| TPSA | 61.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|