C22H29ClN4OS — CID 66690374
N-[5-chloro-4-[[4-cyano-3-(3-methylpentan-3-yl)-1,2-thiazol-5-yl]oxy]-2-methylphenyl]-N',2-dimethylpropanimidamide (PubChem CID 66690374) has the molecular formula C22H29ClN4OS and a molecular weight of 433.02 g/mol. Its IUPAC name is N-[5-chloro-4-[[4-cyano-3-(3-methylpentan-3-yl)-1,2-thiazol-5-yl]oxy]-2-methylphenyl]-N',2-dimethylpropanimidamide.
| Compound Name | N-[5-chloro-4-[[4-cyano-3-(3-methylpentan-3-yl)-1,2-thiazol-5-yl]oxy]-2-methylphenyl]-N',2-dimethylpropanimidamide |
|---|---|
| PubChem CID | 66690374 |
| Molecular Formula | C22H29ClN4OS |
| Molecular Weight | 433.02 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | N-[5-chloro-4-[[4-cyano-3-(3-methylpentan-3-yl)-1,2-thiazol-5-yl]oxy]-2-methylphenyl]-N',2-dimethylpropanimidamide |
| SMILES | CCC(C)(CC)c1nsc(Oc2cc(C)c(N/C(=N/C)C(C)C)cc2Cl)c1C#N |
| InChI | InChI=1S/C22H29ClN4OS/c1-8-22(6,9-2)19-15(12-24)21(29-27-19)28-18-10-14(5)17(11-16(18)23)26-20(25-7)13(3)4/h10-11,13H,8-9H2,1-7H3,(H,25,26) |
| InChIKey | HOMAMWWYQKVHCX-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 70.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.02 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|