C21H18Cl2N4OS — CID 66690589
N'-[4-[[4-cyano-3-(2,4-dichlorophenyl)-1,2-thiazol-5-yl]oxy]-2,5-dimethylphenyl]-N,N-dimethylmethanimidamide (PubChem CID 66690589) has the molecular formula C21H18Cl2N4OS and a molecular weight of 445.38 g/mol. Its IUPAC name is N'-[4-[[4-cyano-3-(2,4-dichlorophenyl)-1,2-thiazol-5-yl]oxy]-2,5-dimethylphenyl]-N,N-dimethylmethanimidamide.
| Compound Name | N'-[4-[[4-cyano-3-(2,4-dichlorophenyl)-1,2-thiazol-5-yl]oxy]-2,5-dimethylphenyl]-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 66690589 |
| Molecular Formula | C21H18Cl2N4OS |
| Molecular Weight | 445.38 g/mol |
| Exact Mass | 444.06 |
| IUPAC Name | N'-[4-[[4-cyano-3-(2,4-dichlorophenyl)-1,2-thiazol-5-yl]oxy]-2,5-dimethylphenyl]-N,N-dimethylmethanimidamide |
| SMILES | Cc1cc(Oc2snc(-c3ccc(Cl)cc3Cl)c2C#N)c(C)cc1/N=C/N(C)C |
| InChI | InChI=1S/C21H18Cl2N4OS/c1-12-8-19(13(2)7-18(12)25-11-27(3)4)28-21-16(10-24)20(26-29-21)15-6-5-14(22)9-17(15)23/h5-9,11H,1-4H3/b25-11+ |
| InChIKey | XVQVJCDMJAKEHT-OPEKNORGSA-N |
| XLogP | 6.62 |
| TPSA | 61.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.38 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|