C10H8IN5OS — CID 66690598
5-(6-iodoimidazo[2,1-b][1,3,4]thiadiazol-2-yl)-2-methoxypyridin-3-amine (PubChem CID 66690598) has the molecular formula C10H8IN5OS and a molecular weight of 373.18 g/mol. Its IUPAC name is 5-(6-iodoimidazo[2,1-b][1,3,4]thiadiazol-2-yl)-2-methoxypyridin-3-amine.
| Compound Name | 5-(6-iodoimidazo[2,1-b][1,3,4]thiadiazol-2-yl)-2-methoxypyridin-3-amine |
|---|---|
| PubChem CID | 66690598 |
| Molecular Formula | C10H8IN5OS |
| Molecular Weight | 373.18 g/mol |
| Exact Mass | 372.95 |
| IUPAC Name | 5-(6-iodoimidazo[2,1-b][1,3,4]thiadiazol-2-yl)-2-methoxypyridin-3-amine |
| SMILES | COc1ncc(-c2nn3cc(I)nc3s2)cc1N |
| InChI | InChI=1S/C10H8IN5OS/c1-17-8-6(12)2-5(3-13-8)9-15-16-4-7(11)14-10(16)18-9/h2-4H,12H2,1H3 |
| InChIKey | DUHKMPUSAACUGF-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 78.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.18 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|