About N-[2-[2-(1,2-thiazol-3-ylamino)phenoxy]phenyl]-1,2-thiazol-3-amine
N-[2-[2-(1,2-thiazol-3-ylamino)phenoxy]phenyl]-1,2-thiazol-3-amine (PubChem CID 66691034) has the molecular formula C18H14N4OS2
and a molecular weight of 366.47 g/mol. Its IUPAC name is N-[2-[2-(1,2-thiazol-3-ylamino)phenoxy]phenyl]-1,2-thiazol-3-amine.
Molecular Properties
| Compound Name | N-[2-[2-(1,2-thiazol-3-ylamino)phenoxy]phenyl]-1,2-thiazol-3-amine |
| PubChem CID | 66691034 |
| Molecular Formula | C18H14N4OS2 |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | N-[2-[2-(1,2-thiazol-3-ylamino)phenoxy]phenyl]-1,2-thiazol-3-amine |
| SMILES | c1ccc(Oc2ccccc2Nc2ccsn2)c(Nc2ccsn2)c1 |
| InChI | InChI=1S/C18H14N4OS2/c1-3-7-15(13(5-1)19-17-9-11-24-21-17)23-16-8-4-2-6-14(16)20-18-10-12-25-22-18/h1-12H,(H,19,21)(H,20,22) |
| InChIKey | LYZBGXAYZLQEOX-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-[2-[2-(1,2-thiazol-3-ylamino)phenoxy]phenyl]-1,2-thiazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[2-(1,2-thiazol-3-ylamino)phenoxy]phenyl]-1,2-thiazol-3-amine?
The IUPAC name of N-[2-[2-(1,2-thiazol-3-ylamino)phenoxy]phenyl]-1,2-thiazol-3-amine (CID 66691034) is N-[2-[2-(1,2-thiazol-3-ylamino)phenoxy]phenyl]-1,2-thiazol-3-amine.
What is the SMILES notation for N-[2-[2-(1,2-thiazol-3-ylamino)phenoxy]phenyl]-1,2-thiazol-3-amine?
The canonical SMILES for N-[2-[2-(1,2-thiazol-3-ylamino)phenoxy]phenyl]-1,2-thiazol-3-amine is c1ccc(Oc2ccccc2Nc2ccsn2)c(Nc2ccsn2)c1.
What is the InChIKey of N-[2-[2-(1,2-thiazol-3-ylamino)phenoxy]phenyl]-1,2-thiazol-3-amine?
The InChIKey is LYZBGXAYZLQEOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14N4OS2/c1-3-7-15(13(5-1)19-17-9-11-24-21-17)23-16-8-4-2-6-14(16)20-18-10-12-25-22-18/h1-12H,(H,19,21)(H,20,22).
What are the key properties of N-[2-[2-(1,2-thiazol-3-ylamino)phenoxy]phenyl]-1,2-thiazol-3-amine?
N-[2-[2-(1,2-thiazol-3-ylamino)phenoxy]phenyl]-1,2-thiazol-3-amine has a molecular weight of 366.47 g/mol, XLogP of 5.88, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[2-(1,2-thiazol-3-ylamino)phenoxy]phenyl]-1,2-thiazol-3-amine is sourced from PubChem (CID 66691034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).