C23H24ClN3OS — CID 66691081
N-[4-[(4-chloro-3-phenyl-1,2-thiazol-5-yl)oxy]-2,5-dimethylphenyl]-1-piperidin-1-ylmethanimine (PubChem CID 66691081) has the molecular formula C23H24ClN3OS and a molecular weight of 425.99 g/mol. Its IUPAC name is N-[4-[(4-chloro-3-phenyl-1,2-thiazol-5-yl)oxy]-2,5-dimethylphenyl]-1-piperidin-1-ylmethanimine.
| Compound Name | N-[4-[(4-chloro-3-phenyl-1,2-thiazol-5-yl)oxy]-2,5-dimethylphenyl]-1-piperidin-1-ylmethanimine |
|---|---|
| PubChem CID | 66691081 |
| Molecular Formula | C23H24ClN3OS |
| Molecular Weight | 425.99 g/mol |
| Exact Mass | 425.13 |
| IUPAC Name | N-[4-[(4-chloro-3-phenyl-1,2-thiazol-5-yl)oxy]-2,5-dimethylphenyl]-1-piperidin-1-ylmethanimine |
| SMILES | Cc1cc(Oc2snc(-c3ccccc3)c2Cl)c(C)cc1/N=C/N1CCCCC1 |
| InChI | InChI=1S/C23H24ClN3OS/c1-16-14-20(17(2)13-19(16)25-15-27-11-7-4-8-12-27)28-23-21(24)22(26-29-23)18-9-5-3-6-10-18/h3,5-6,9-10,13-15H,4,7-8,11-12H2,1-2H3/b25-15+ |
| InChIKey | QCZGDWPWJIISAY-MFKUBSTISA-N |
| XLogP | 7.02 |
| TPSA | 37.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.99 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|