C15H17F3IN5O2 — CID 66691224
[6-(cyclopentylamino)-3-iodoimidazo[1,2-b]pyridazin-8-yl]-(3,3,3-trifluoropropyl)carbamic acid (PubChem CID 66691224) has the molecular formula C15H17F3IN5O2 and a molecular weight of 483.23 g/mol. Its IUPAC name is [6-(cyclopentylamino)-3-iodoimidazo[1,2-b]pyridazin-8-yl]-(3,3,3-trifluoropropyl)carbamic acid.
| Compound Name | [6-(cyclopentylamino)-3-iodoimidazo[1,2-b]pyridazin-8-yl]-(3,3,3-trifluoropropyl)carbamic acid |
|---|---|
| PubChem CID | 66691224 |
| Molecular Formula | C15H17F3IN5O2 |
| Molecular Weight | 483.23 g/mol |
| Exact Mass | 483.04 |
| IUPAC Name | [6-(cyclopentylamino)-3-iodoimidazo[1,2-b]pyridazin-8-yl]-(3,3,3-trifluoropropyl)carbamic acid |
| SMILES | O=C(O)N(CCC(F)(F)F)c1cc(NC2CCCC2)nn2c(I)cnc12 |
| InChI | InChI=1S/C15H17F3IN5O2/c16-15(17,18)5-6-23(14(25)26)10-7-12(21-9-3-1-2-4-9)22-24-11(19)8-20-13(10)24/h7-9H,1-6H2,(H,21,22)(H,25,26) |
| InChIKey | UMHYDIIZMIUAER-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 82.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.23 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|