C17H32O4Si — CID 66691246
(3aR,4S,5R,6aS)-5-hydroxy-4-[tri(propan-2-yl)silyloxymethyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one (PubChem CID 66691246) has the molecular formula C17H32O4Si and a molecular weight of 328.53 g/mol. Its IUPAC name is (3aR,4S,5R,6aS)-5-hydroxy-4-[tri(propan-2-yl)silyloxymethyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one.
| Compound Name | (3aR,4S,5R,6aS)-5-hydroxy-4-[tri(propan-2-yl)silyloxymethyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 66691246 |
| Molecular Formula | C17H32O4Si |
| Molecular Weight | 328.53 g/mol |
| Exact Mass | 328.21 |
| IUPAC Name | (3aR,4S,5R,6aS)-5-hydroxy-4-[tri(propan-2-yl)silyloxymethyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
| SMILES | CC(C)[Si](OC[C@@H]1[C@H]2CC(=O)O[C@H]2C[C@H]1O)(C(C)C)C(C)C |
| InChI | InChI=1S/C17H32O4Si/c1-10(2)22(11(3)4,12(5)6)20-9-14-13-7-17(19)21-16(13)8-15(14)18/h10-16,18H,7-9H2,1-6H3/t13-,14-,15-,16+/m1/s1 |
| InChIKey | XOPFQDDNZIDNMV-FPCVCCKLSA-N |
| XLogP | 3.49 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.53 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|