About cyclohexa-2,5-diene-1,4-dione;methoxymethane
cyclohexa-2,5-diene-1,4-dione;methoxymethane (PubChem CID 66691489) has the molecular formula C8H10O3
and a molecular weight of 154.16 g/mol. Its IUPAC name is cyclohexa-2,5-diene-1,4-dione;methoxymethane.
Molecular Properties
| Compound Name | cyclohexa-2,5-diene-1,4-dione;methoxymethane |
| PubChem CID | 66691489 |
| Molecular Formula | C8H10O3 |
| Molecular Weight | 154.16 g/mol |
| Exact Mass | 154.06 |
| IUPAC Name | cyclohexa-2,5-diene-1,4-dione;methoxymethane |
| SMILES | COC.O=C1C=CC(=O)C=C1 |
| InChI | InChI=1S/C6H4O2.C2H6O/c7-5-1-2-6(8)4-3-5;1-3-2/h1-4H;1-2H3 |
| InChIKey | FAKBPVAVIJLFBE-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.16 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|
Analyze cyclohexa-2,5-diene-1,4-dione;methoxymethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexa-2,5-diene-1,4-dione;methoxymethane?
The IUPAC name of cyclohexa-2,5-diene-1,4-dione;methoxymethane (CID 66691489) is cyclohexa-2,5-diene-1,4-dione;methoxymethane.
What is the SMILES notation for cyclohexa-2,5-diene-1,4-dione;methoxymethane?
The canonical SMILES for cyclohexa-2,5-diene-1,4-dione;methoxymethane is COC.O=C1C=CC(=O)C=C1.
What is the InChIKey of cyclohexa-2,5-diene-1,4-dione;methoxymethane?
The InChIKey is FAKBPVAVIJLFBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4O2.C2H6O/c7-5-1-2-6(8)4-3-5;1-3-2/h1-4H;1-2H3.
What are the key properties of cyclohexa-2,5-diene-1,4-dione;methoxymethane?
cyclohexa-2,5-diene-1,4-dione;methoxymethane has a molecular weight of 154.16 g/mol, XLogP of 0.51, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexa-2,5-diene-1,4-dione;methoxymethane is sourced from PubChem (CID 66691489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).