About 2-(3-aminopyrazolo[1,5-a]pyrimidin-7-yl)-2-(2-hydroxyethylamino)ethanol
2-(3-aminopyrazolo[1,5-a]pyrimidin-7-yl)-2-(2-hydroxyethylamino)ethanol (PubChem CID 66691767) has the molecular formula C10H15N5O2
and a molecular weight of 237.26 g/mol. Its IUPAC name is 2-(3-aminopyrazolo[1,5-a]pyrimidin-7-yl)-2-(2-hydroxyethylamino)ethanol.
Molecular Properties
| Compound Name | 2-(3-aminopyrazolo[1,5-a]pyrimidin-7-yl)-2-(2-hydroxyethylamino)ethanol |
| PubChem CID | 66691767 |
| Molecular Formula | C10H15N5O2 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | 2-(3-aminopyrazolo[1,5-a]pyrimidin-7-yl)-2-(2-hydroxyethylamino)ethanol |
| SMILES | Nc1cnn2c(C(CO)NCCO)ccnc12 |
| InChI | InChI=1S/C10H15N5O2/c11-7-5-14-15-9(1-2-13-10(7)15)8(6-17)12-3-4-16/h1-2,5,8,12,16-17H,3-4,6,11H2 |
| InChIKey | GKVLDBHPICRBLF-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 108.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-(3-aminopyrazolo[1,5-a]pyrimidin-7-yl)-2-(2-hydroxyethylamino)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-aminopyrazolo[1,5-a]pyrimidin-7-yl)-2-(2-hydroxyethylamino)ethanol?
The IUPAC name of 2-(3-aminopyrazolo[1,5-a]pyrimidin-7-yl)-2-(2-hydroxyethylamino)ethanol (CID 66691767) is 2-(3-aminopyrazolo[1,5-a]pyrimidin-7-yl)-2-(2-hydroxyethylamino)ethanol.
What is the SMILES notation for 2-(3-aminopyrazolo[1,5-a]pyrimidin-7-yl)-2-(2-hydroxyethylamino)ethanol?
The canonical SMILES for 2-(3-aminopyrazolo[1,5-a]pyrimidin-7-yl)-2-(2-hydroxyethylamino)ethanol is Nc1cnn2c(C(CO)NCCO)ccnc12.
What is the InChIKey of 2-(3-aminopyrazolo[1,5-a]pyrimidin-7-yl)-2-(2-hydroxyethylamino)ethanol?
The InChIKey is GKVLDBHPICRBLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N5O2/c11-7-5-14-15-9(1-2-13-10(7)15)8(6-17)12-3-4-16/h1-2,5,8,12,16-17H,3-4,6,11H2.
What are the key properties of 2-(3-aminopyrazolo[1,5-a]pyrimidin-7-yl)-2-(2-hydroxyethylamino)ethanol?
2-(3-aminopyrazolo[1,5-a]pyrimidin-7-yl)-2-(2-hydroxyethylamino)ethanol has a molecular weight of 237.26 g/mol, XLogP of -1.07, 5 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-aminopyrazolo[1,5-a]pyrimidin-7-yl)-2-(2-hydroxyethylamino)ethanol is sourced from PubChem (CID 66691767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).