C9H14N2O2 — CID 66691849
1-but-3-enyl-1H-imidazol-1-ium acetate (PubChem CID 66691849) has the molecular formula C9H14N2O2 and a molecular weight of 182.22 g/mol. Its IUPAC name is 1-but-3-enyl-1H-imidazol-1-ium acetate.
| Compound Name | 1-but-3-enyl-1H-imidazol-1-ium acetate |
|---|---|
| PubChem CID | 66691849 |
| Molecular Formula | C9H14N2O2 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | 1-but-3-enyl-1H-imidazol-1-ium acetate |
| SMILES | C=CCC[NH+]1C=CN=C1.CC(=O)[O-] |
| InChI | InChI=1S/C7H10N2.C2H4O2/c1-2-3-5-9-6-4-8-7-9;1-2(3)4/h2,4,6-7H,1,3,5H2;1H3,(H,3,4) |
| InChIKey | KBPHZJPAXGUGJE-UHFFFAOYSA-N |
| XLogP | -1.28 |
| TPSA | 56.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|