About 5-(2,2-diaminoethyl)-4-methyl-1,2-dihydropyrazol-3-one
5-(2,2-diaminoethyl)-4-methyl-1,2-dihydropyrazol-3-one (PubChem CID 66691892) has the molecular formula C6H12N4O
and a molecular weight of 156.19 g/mol. Its IUPAC name is 5-(2,2-diaminoethyl)-4-methyl-1,2-dihydropyrazol-3-one.
Molecular Properties
| Compound Name | 5-(2,2-diaminoethyl)-4-methyl-1,2-dihydropyrazol-3-one |
| PubChem CID | 66691892 |
| Molecular Formula | C6H12N4O |
| Molecular Weight | 156.19 g/mol |
| Exact Mass | 156.10 |
| IUPAC Name | 5-(2,2-diaminoethyl)-4-methyl-1,2-dihydropyrazol-3-one |
| SMILES | Cc1c(CC(N)N)[nH][nH]c1=O |
| InChI | InChI=1S/C6H12N4O/c1-3-4(2-5(7)8)9-10-6(3)11/h5H,2,7-8H2,1H3,(H2,9,10,11) |
| InChIKey | JGJUKRLJNSLADK-UHFFFAOYSA-N |
| XLogP | -1.20 |
| TPSA | 100.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.19 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 5-(2,2-diaminoethyl)-4-methyl-1,2-dihydropyrazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,2-diaminoethyl)-4-methyl-1,2-dihydropyrazol-3-one?
The IUPAC name of 5-(2,2-diaminoethyl)-4-methyl-1,2-dihydropyrazol-3-one (CID 66691892) is 5-(2,2-diaminoethyl)-4-methyl-1,2-dihydropyrazol-3-one.
What is the SMILES notation for 5-(2,2-diaminoethyl)-4-methyl-1,2-dihydropyrazol-3-one?
The canonical SMILES for 5-(2,2-diaminoethyl)-4-methyl-1,2-dihydropyrazol-3-one is Cc1c(CC(N)N)[nH][nH]c1=O.
What is the InChIKey of 5-(2,2-diaminoethyl)-4-methyl-1,2-dihydropyrazol-3-one?
The InChIKey is JGJUKRLJNSLADK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N4O/c1-3-4(2-5(7)8)9-10-6(3)11/h5H,2,7-8H2,1H3,(H2,9,10,11).
What are the key properties of 5-(2,2-diaminoethyl)-4-methyl-1,2-dihydropyrazol-3-one?
5-(2,2-diaminoethyl)-4-methyl-1,2-dihydropyrazol-3-one has a molecular weight of 156.19 g/mol, XLogP of -1.20, 2 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,2-diaminoethyl)-4-methyl-1,2-dihydropyrazol-3-one is sourced from PubChem (CID 66691892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).