About 5-prop-2-enyl-1H-1,2,4-triazol-3-amine
5-prop-2-enyl-1H-1,2,4-triazol-3-amine (PubChem CID 66693144) has the molecular formula C5H8N4
and a molecular weight of 124.15 g/mol. Its IUPAC name is 5-prop-2-enyl-1H-1,2,4-triazol-3-amine.
Molecular Properties
| Compound Name | 5-prop-2-enyl-1H-1,2,4-triazol-3-amine |
| PubChem CID | 66693144 |
| Molecular Formula | C5H8N4 |
| Molecular Weight | 124.15 g/mol |
| Exact Mass | 124.07 |
| IUPAC Name | 5-prop-2-enyl-1H-1,2,4-triazol-3-amine |
| SMILES | C=CCc1nc(N)n[nH]1 |
| InChI | InChI=1S/C5H8N4/c1-2-3-4-7-5(6)9-8-4/h2H,1,3H2,(H3,6,7,8,9) |
| InChIKey | TZDOPUDUQDFULL-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.15 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-prop-2-enyl-1H-1,2,4-triazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-prop-2-enyl-1H-1,2,4-triazol-3-amine?
The IUPAC name of 5-prop-2-enyl-1H-1,2,4-triazol-3-amine (CID 66693144) is 5-prop-2-enyl-1H-1,2,4-triazol-3-amine.
What is the SMILES notation for 5-prop-2-enyl-1H-1,2,4-triazol-3-amine?
The canonical SMILES for 5-prop-2-enyl-1H-1,2,4-triazol-3-amine is C=CCc1nc(N)n[nH]1.
What is the InChIKey of 5-prop-2-enyl-1H-1,2,4-triazol-3-amine?
The InChIKey is TZDOPUDUQDFULL-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N4/c1-2-3-4-7-5(6)9-8-4/h2H,1,3H2,(H3,6,7,8,9).
What are the key properties of 5-prop-2-enyl-1H-1,2,4-triazol-3-amine?
5-prop-2-enyl-1H-1,2,4-triazol-3-amine has a molecular weight of 124.15 g/mol, XLogP of 0.12, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-prop-2-enyl-1H-1,2,4-triazol-3-amine is sourced from PubChem (CID 66693144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).