About 2-ethenylporphyrin
2-ethenylporphyrin (PubChem CID 66693207) has the molecular formula C22H14N4
and a molecular weight of 334.38 g/mol. Its IUPAC name is 2-ethenylporphyrin.
Molecular Properties
| Compound Name | 2-ethenylporphyrin |
| PubChem CID | 66693207 |
| Molecular Formula | C22H14N4 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | 2-ethenylporphyrin |
| SMILES | C=CC1=CC2=N/C1=C\C1=N/C(=C\C3=N/C(=C\C4=N/C(=C\2)C=C4)C=C3)C=C1 |
| InChI | InChI=1S/C22H14N4/c1-2-14-9-21-12-19-6-5-17(24-19)10-15-3-4-16(23-15)11-18-7-8-20(25-18)13-22(14)26-21/h2-13H,1H2/b15-10-,16-11-,17-10-,18-11-,19-12-,20-13-,21-12-,22-13- |
| InChIKey | SDUZUHMQQVRLED-LGRBBWKFSA-N |
| XLogP | 4.14 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-ethenylporphyrin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethenylporphyrin?
The IUPAC name of 2-ethenylporphyrin (CID 66693207) is 2-ethenylporphyrin.
What is the SMILES notation for 2-ethenylporphyrin?
The canonical SMILES for 2-ethenylporphyrin is C=CC1=CC2=N/C1=C\C1=N/C(=C\C3=N/C(=C\C4=N/C(=C\2)C=C4)C=C3)C=C1.
What is the InChIKey of 2-ethenylporphyrin?
The InChIKey is SDUZUHMQQVRLED-LGRBBWKFSA-N. The full InChI is InChI=1S/C22H14N4/c1-2-14-9-21-12-19-6-5-17(24-19)10-15-3-4-16(23-15)11-18-7-8-20(25-18)13-22(14)26-21/h2-13H,1H2/b15-10-,16-11-,17-10-,18-11-,19-12-,20-13-,21-12-,22-13-.
What are the key properties of 2-ethenylporphyrin?
2-ethenylporphyrin has a molecular weight of 334.38 g/mol, XLogP of 4.14, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethenylporphyrin is sourced from PubChem (CID 66693207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).