About 3,4-dihydro-2H-1,2-benzoxazin-6-ol
3,4-dihydro-2H-1,2-benzoxazin-6-ol (PubChem CID 66693230) has the molecular formula C8H9NO2
and a molecular weight of 151.16 g/mol. Its IUPAC name is 3,4-dihydro-2H-1,2-benzoxazin-6-ol.
Molecular Properties
| Compound Name | 3,4-dihydro-2H-1,2-benzoxazin-6-ol |
| PubChem CID | 66693230 |
| Molecular Formula | C8H9NO2 |
| Molecular Weight | 151.16 g/mol |
| Exact Mass | 151.06 |
| IUPAC Name | 3,4-dihydro-2H-1,2-benzoxazin-6-ol |
| SMILES | Oc1ccc2c(c1)CCNO2 |
| InChI | InChI=1S/C8H9NO2/c10-7-1-2-8-6(5-7)3-4-9-11-8/h1-2,5,9-10H,3-4H2 |
| InChIKey | XVZLWHCKSOUAED-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.16 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,4-dihydro-2H-1,2-benzoxazin-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dihydro-2H-1,2-benzoxazin-6-ol?
The IUPAC name of 3,4-dihydro-2H-1,2-benzoxazin-6-ol (CID 66693230) is 3,4-dihydro-2H-1,2-benzoxazin-6-ol.
What is the SMILES notation for 3,4-dihydro-2H-1,2-benzoxazin-6-ol?
The canonical SMILES for 3,4-dihydro-2H-1,2-benzoxazin-6-ol is Oc1ccc2c(c1)CCNO2.
What is the InChIKey of 3,4-dihydro-2H-1,2-benzoxazin-6-ol?
The InChIKey is XVZLWHCKSOUAED-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO2/c10-7-1-2-8-6(5-7)3-4-9-11-8/h1-2,5,9-10H,3-4H2.
What are the key properties of 3,4-dihydro-2H-1,2-benzoxazin-6-ol?
3,4-dihydro-2H-1,2-benzoxazin-6-ol has a molecular weight of 151.16 g/mol, XLogP of 0.83, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dihydro-2H-1,2-benzoxazin-6-ol is sourced from PubChem (CID 66693230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).