About 1,3,4-triethylpyrazolo[3,4-d]pyrimidine
1,3,4-triethylpyrazolo[3,4-d]pyrimidine (PubChem CID 66693343) has the molecular formula C11H16N4
and a molecular weight of 204.28 g/mol. Its IUPAC name is 1,3,4-triethylpyrazolo[3,4-d]pyrimidine.
Molecular Properties
| Compound Name | 1,3,4-triethylpyrazolo[3,4-d]pyrimidine |
| PubChem CID | 66693343 |
| Molecular Formula | C11H16N4 |
| Molecular Weight | 204.28 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | 1,3,4-triethylpyrazolo[3,4-d]pyrimidine |
| SMILES | CCc1ncnc2c1c(CC)nn2CC |
| InChI | InChI=1S/C11H16N4/c1-4-8-10-9(5-2)14-15(6-3)11(10)13-7-12-8/h7H,4-6H2,1-3H3 |
| InChIKey | KFQJBCHOCVYDCA-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.28 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,3,4-triethylpyrazolo[3,4-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3,4-triethylpyrazolo[3,4-d]pyrimidine?
The IUPAC name of 1,3,4-triethylpyrazolo[3,4-d]pyrimidine (CID 66693343) is 1,3,4-triethylpyrazolo[3,4-d]pyrimidine.
What is the SMILES notation for 1,3,4-triethylpyrazolo[3,4-d]pyrimidine?
The canonical SMILES for 1,3,4-triethylpyrazolo[3,4-d]pyrimidine is CCc1ncnc2c1c(CC)nn2CC.
What is the InChIKey of 1,3,4-triethylpyrazolo[3,4-d]pyrimidine?
The InChIKey is KFQJBCHOCVYDCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N4/c1-4-8-10-9(5-2)14-15(6-3)11(10)13-7-12-8/h7H,4-6H2,1-3H3.
What are the key properties of 1,3,4-triethylpyrazolo[3,4-d]pyrimidine?
1,3,4-triethylpyrazolo[3,4-d]pyrimidine has a molecular weight of 204.28 g/mol, XLogP of 1.97, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3,4-triethylpyrazolo[3,4-d]pyrimidine is sourced from PubChem (CID 66693343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).