C33H39F2N5O5 — CID 66693526
benzyl 3-(butoxycarbonylamino)-2-[3-(2,5-difluorophenyl)pyrrolidin-1-yl]-2-(pyrimidin-5-yloxymethyl)piperidine-1-carboxylate (PubChem CID 66693526) has the molecular formula C33H39F2N5O5 and a molecular weight of 623.70 g/mol. Its IUPAC name is benzyl 3-(butoxycarbonylamino)-2-[3-(2,5-difluorophenyl)pyrrolidin-1-yl]-2-(pyrimidin-5-yloxymethyl)piperidine-1-carboxylate.
| Compound Name | benzyl 3-(butoxycarbonylamino)-2-[3-(2,5-difluorophenyl)pyrrolidin-1-yl]-2-(pyrimidin-5-yloxymethyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 66693526 |
| Molecular Formula | C33H39F2N5O5 |
| Molecular Weight | 623.70 g/mol |
| Exact Mass | 623.29 |
| IUPAC Name | benzyl 3-(butoxycarbonylamino)-2-[3-(2,5-difluorophenyl)pyrrolidin-1-yl]-2-(pyrimidin-5-yloxymethyl)piperidine-1-carboxylate |
| SMILES | CCCCOC(=O)NC1CCCN(C(=O)OCc2ccccc2)C1(COc1cncnc1)N1CCC(c2cc(F)ccc2F)C1 |
| InChI | InChI=1S/C33H39F2N5O5/c1-2-3-16-43-31(41)38-30-10-7-14-40(32(42)44-21-24-8-5-4-6-9-24)33(30,22-45-27-18-36-23-37-19-27)39-15-13-25(20-39)28-17-26(34)11-12-29(28)35/h4-6,8-9,11-12,17-19,23,25,30H,2-3,7,10,13-16,20-22H2,1H3,(H,38,41) |
| InChIKey | FWCATZQLKMOFTE-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 106.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.70 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|