About 5-(3-fluorophenyl)-3-methyl-4,5-dihydro-1H-pyrazole
5-(3-fluorophenyl)-3-methyl-4,5-dihydro-1H-pyrazole (PubChem CID 66693717) has the molecular formula C10H11FN2
and a molecular weight of 178.21 g/mol. Its IUPAC name is 5-(3-fluorophenyl)-3-methyl-4,5-dihydro-1H-pyrazole.
Molecular Properties
| Compound Name | 5-(3-fluorophenyl)-3-methyl-4,5-dihydro-1H-pyrazole |
| PubChem CID | 66693717 |
| Molecular Formula | C10H11FN2 |
| Molecular Weight | 178.21 g/mol |
| Exact Mass | 178.09 |
| IUPAC Name | 5-(3-fluorophenyl)-3-methyl-4,5-dihydro-1H-pyrazole |
| SMILES | CC1=NNC(c2cccc(F)c2)C1 |
| InChI | InChI=1S/C10H11FN2/c1-7-5-10(13-12-7)8-3-2-4-9(11)6-8/h2-4,6,10,13H,5H2,1H3 |
| InChIKey | SCCYMOGVJZPHOR-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.21 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(3-fluorophenyl)-3-methyl-4,5-dihydro-1H-pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-fluorophenyl)-3-methyl-4,5-dihydro-1H-pyrazole?
The IUPAC name of 5-(3-fluorophenyl)-3-methyl-4,5-dihydro-1H-pyrazole (CID 66693717) is 5-(3-fluorophenyl)-3-methyl-4,5-dihydro-1H-pyrazole.
What is the SMILES notation for 5-(3-fluorophenyl)-3-methyl-4,5-dihydro-1H-pyrazole?
The canonical SMILES for 5-(3-fluorophenyl)-3-methyl-4,5-dihydro-1H-pyrazole is CC1=NNC(c2cccc(F)c2)C1.
What is the InChIKey of 5-(3-fluorophenyl)-3-methyl-4,5-dihydro-1H-pyrazole?
The InChIKey is SCCYMOGVJZPHOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11FN2/c1-7-5-10(13-12-7)8-3-2-4-9(11)6-8/h2-4,6,10,13H,5H2,1H3.
What are the key properties of 5-(3-fluorophenyl)-3-methyl-4,5-dihydro-1H-pyrazole?
5-(3-fluorophenyl)-3-methyl-4,5-dihydro-1H-pyrazole has a molecular weight of 178.21 g/mol, XLogP of 2.24, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-fluorophenyl)-3-methyl-4,5-dihydro-1H-pyrazole is sourced from PubChem (CID 66693717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).