C15H8F2IN5O2S2 — CID 66693951
2,4-difluoro-N-[5-(5-iodoimidazo[2,1-b][1,3,4]thiadiazol-2-yl)-3-pyridinyl]benzenesulfonamide (PubChem CID 66693951) has the molecular formula C15H8F2IN5O2S2 and a molecular weight of 519.30 g/mol. Its IUPAC name is 2,4-difluoro-N-[5-(5-iodoimidazo[2,1-b][1,3,4]thiadiazol-2-yl)-3-pyridinyl]benzenesulfonamide.
| Compound Name | 2,4-difluoro-N-[5-(5-iodoimidazo[2,1-b][1,3,4]thiadiazol-2-yl)-3-pyridinyl]benzenesulfonamide |
|---|---|
| PubChem CID | 66693951 |
| Molecular Formula | C15H8F2IN5O2S2 |
| Molecular Weight | 519.30 g/mol |
| Exact Mass | 518.91 |
| IUPAC Name | 2,4-difluoro-N-[5-(5-iodoimidazo[2,1-b][1,3,4]thiadiazol-2-yl)-3-pyridinyl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1cncc(-c2nn3c(I)cnc3s2)c1)c1ccc(F)cc1F |
| InChI | InChI=1S/C15H8F2IN5O2S2/c16-9-1-2-12(11(17)4-9)27(24,25)22-10-3-8(5-19-6-10)14-21-23-13(18)7-20-15(23)26-14/h1-7,22H |
| InChIKey | WJISFXLDYOAWHV-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 89.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.30 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|