About 3,5-difluoro-1-phenylcyclohexa-1,3-diene
3,5-difluoro-1-phenylcyclohexa-1,3-diene (PubChem CID 66693994) has the molecular formula C12H10F2
and a molecular weight of 192.21 g/mol. Its IUPAC name is 3,5-difluoro-1-phenylcyclohexa-1,3-diene.
Molecular Properties
| Compound Name | 3,5-difluoro-1-phenylcyclohexa-1,3-diene |
| PubChem CID | 66693994 |
| Molecular Formula | C12H10F2 |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | 3,5-difluoro-1-phenylcyclohexa-1,3-diene |
| SMILES | FC1=CC(F)CC(c2ccccc2)=C1 |
| InChI | InChI=1S/C12H10F2/c13-11-6-10(7-12(14)8-11)9-4-2-1-3-5-9/h1-6,8,12H,7H2 |
| InChIKey | XZGTZONLYVGOEY-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.21 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 3,5-difluoro-1-phenylcyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-difluoro-1-phenylcyclohexa-1,3-diene?
The IUPAC name of 3,5-difluoro-1-phenylcyclohexa-1,3-diene (CID 66693994) is 3,5-difluoro-1-phenylcyclohexa-1,3-diene.
What is the SMILES notation for 3,5-difluoro-1-phenylcyclohexa-1,3-diene?
The canonical SMILES for 3,5-difluoro-1-phenylcyclohexa-1,3-diene is FC1=CC(F)CC(c2ccccc2)=C1.
What is the InChIKey of 3,5-difluoro-1-phenylcyclohexa-1,3-diene?
The InChIKey is XZGTZONLYVGOEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10F2/c13-11-6-10(7-12(14)8-11)9-4-2-1-3-5-9/h1-6,8,12H,7H2.
What are the key properties of 3,5-difluoro-1-phenylcyclohexa-1,3-diene?
3,5-difluoro-1-phenylcyclohexa-1,3-diene has a molecular weight of 192.21 g/mol, XLogP of 3.67, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-difluoro-1-phenylcyclohexa-1,3-diene is sourced from PubChem (CID 66693994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).