C25H33NO8 — CID 6669402
(2S,3R,4R)-N-(2,2-dimethoxyethyl)-2-ethoxy-3-(3-hydroxypropyl)-N-methyl-4-(4-oxochromen-3-yl)-3,4-dihydro-2H-pyran-6-carboxamide (PubChem CID 6669402) has the molecular formula C25H33NO8 and a molecular weight of 475.54 g/mol. Its IUPAC name is (2S,3R,4R)-N-(2,2-dimethoxyethyl)-2-ethoxy-3-(3-hydroxypropyl)-N-methyl-4-(4-oxochromen-3-yl)-3,4-dihydro-2H-pyran-6-carboxamide.
| Compound Name | (2S,3R,4R)-N-(2,2-dimethoxyethyl)-2-ethoxy-3-(3-hydroxypropyl)-N-methyl-4-(4-oxochromen-3-yl)-3,4-dihydro-2H-pyran-6-carboxamide |
|---|---|
| PubChem CID | 6669402 |
| Molecular Formula | C25H33NO8 |
| Molecular Weight | 475.54 g/mol |
| Exact Mass | 475.22 |
| IUPAC Name | (2S,3R,4R)-N-(2,2-dimethoxyethyl)-2-ethoxy-3-(3-hydroxypropyl)-N-methyl-4-(4-oxochromen-3-yl)-3,4-dihydro-2H-pyran-6-carboxamide |
| SMILES | CCO[C@H]1OC(C(=O)N(C)CC(OC)OC)=C[C@@H](c2coc3ccccc3c2=O)[C@H]1CCCO |
| InChI | InChI=1S/C25H33NO8/c1-5-32-25-16(10-8-12-27)18(19-15-33-20-11-7-6-9-17(20)23(19)28)13-21(34-25)24(29)26(2)14-22(30-3)31-4/h6-7,9,11,13,15-16,18,22,25,27H,5,8,10,12,14H2,1-4H3/t16-,18-,25+/m1/s1 |
| InChIKey | CWSXUEQXVZCCOE-UAYVVIHISA-N |
| XLogP | 2.62 |
| TPSA | 107.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.54 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|